CymitQuimica logo

CAS 106584-13-8

:

2-(2-thienyl) phenol

Description:
2-(2-Thienyl)phenol, with the CAS number 106584-13-8, is an organic compound characterized by the presence of both a phenolic hydroxyl group and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic systems. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding, which can influence its solubility and reactivity in various chemical environments. 2-(2-Thienyl)phenol may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and materials science. Its structural features suggest potential applications in organic synthesis, as well as in the development of functional materials, due to the interplay between its aromatic and heteroaromatic components. Overall, this compound exemplifies the diverse chemistry associated with substituted phenols and heterocycles.
Formula:C10H8OS
InChI:InChI=1/C10H8OS/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7,11H
InChI key:IGXFRPBULGVNKY-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)c1cccs1)O
Synonyms:
  • 2-Thiophen-2-Ylphenol
  • 2-(Thiophen-2-Yl)Phenol
Found 3 products.