CymitQuimica logo

CAS 106584-14-9

:

2-(2-Furanyl)phenol

Description:
2-(2-Furanyl)phenol, also known by its CAS number 106584-14-9, is an organic compound characterized by the presence of both a furan ring and a phenolic group. This compound features a furan moiety attached to the ortho position of a phenolic structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of the hydroxyl (-OH) group in the phenol structure imparts acidity, allowing it to participate in hydrogen bonding and making it soluble in polar solvents. Additionally, the furan ring can engage in various chemical reactions, including electrophilic substitution and oxidation. 2-(2-Furanyl)phenol may have applications in organic synthesis, pharmaceuticals, and materials science due to its potential biological activity and ability to act as a building block for more complex molecules. Its specific reactivity and interactions can vary based on the surrounding chemical environment and conditions.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7,11H
InChI key:InChIKey=HMSYRKLORAGEJP-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC=CO2)C=CC=C1
Synonyms:
  • 2-(2-Furanyl)phenol
  • 2-(2-Furyl)phenol
  • Phenol, 2-(2-furanyl)-
Found 2 products.