CAS 106596-81-0
:ethyl 3-(benzyloxy)cyclobutanecarboxylate
Description:
Ethyl 3-(benzyloxy)cyclobutanecarboxylate is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. This compound features an ethyl ester functional group, indicating that it is an ester derived from cyclobutanecarboxylic acid. The presence of a benzyloxy group suggests that a benzyl group is attached through an ether linkage, contributing to the compound's reactivity and potential applications in organic synthesis. Ethyl 3-(benzyloxy)cyclobutanecarboxylate is likely to exhibit moderate polarity due to the ester and ether functionalities, influencing its solubility in various organic solvents. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, making it of interest in synthetic organic chemistry. Its unique structure may provide specific biological activities or properties, which could be explored in pharmaceutical or material science contexts. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C14H18O3
InChI:InChI=1S/C14H18O3/c1-2-16-14(15)12-8-13(9-12)17-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3
InChI key:BOBSPEXKRNDFCE-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CC(C1)OCC2=CC=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
