CAS 106658-10-0

2-Propan-1,1,1,2,3,3,3-d7-amine, hydrochloride

Description:

2-Propan-1,1,1,2,3,3,3-d7-amine, hydrochloride, is a deuterated derivative of isopropylamine, characterized by the presence of deuterium atoms replacing certain hydrogen atoms in its molecular structure. This compound is typically used in research and analytical chemistry, particularly in studies involving isotopic labeling, which can help trace metabolic pathways or reaction mechanisms. As a hydrochloride salt, it is soluble in water and exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds. The presence of deuterium can influence the physical and chemical properties of the compound, including its reactivity and stability. The deuterated nature of this amine allows for enhanced NMR spectroscopy analysis, providing clearer insights into molecular dynamics. Overall, 2-Propan-1,1,1,2,3,3,3-d7-amine, hydrochloride serves as a valuable tool in various scientific applications, particularly in the fields of organic chemistry and pharmacology.

Formula: C₃H₂D₇N·ClH

InChI: InChI=1S/C3H9N.ClH/c1-3(2)4;/h3H,4H2,1-2H3;1H/i1D3,2D3,3D;

InChI key: InChIKey=ISYORFGKSZLPNW-NDCOIKGTSA-N

SMILES: C(C([2H])([2H])[2H])(C([2H])([2H])[2H])(N)[2H].Cl

Synonyms:

• 2-Aminopropane-d7
• 2-Propan-1,1,1,2,3,3,3-d₇-amine, hydrochloride
• 2-Propan-1,1,1,2,3,3,3-d7-amine, hydrochloride

Propan-2-amine-d7 (hydrochloride)

CAS: 106658-10-0

Propan-2-amine-d7 (hydrochloride)

Purity: 98%

Molecular weight: 102.09

Ref: 10-F555325

2-Propan-1,1,1,2,3,3,3-d7-amine hydrochloride

CAS: 106658-10-0

2-Propan-1,1,1,2,3,3,3-d7-amine hydrochloride

Formula: C₃H₃ClD₇N

Purity: 98% 98atom%D

Molecular weight: 102.61

Ref: 54-DE2455

iso-Propyl-d7-amine HCl

CAS: 106658-10-0

Formula: (CD₃)₂CDNH₂HCl

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 102.09411

Ref: 3U-D5193

Propan-d7-2-amine hydrochloride

CAS: 106658-10-0

Formula: C₃H₁₀ClN

Purity: 98% 98atom%D

Molecular weight: 102.61

Ref: IN-DG01395931

Isopropyl-d7-amine Hydrochloride

Controlled Product

CAS: 106658-10-0

Applications Isopropyl-d7-amine Hydrochloride is the hydrochloride analogue of Isopropyl-d7-amine (I823977), which may act as a potential protease inhibitor but also takes part in numerous organic chemical reactions such as amide synthesis.
References Dam, J.H. et al.: Chem. A. Eur. J., 16, 6820 (2010); Latli, B. et al.: J Labelled. Compd. Radiopharm., 48, 447 (2005)

Formula: C₃D₇H₂N·HCl

Color and Shape: Neat

Molecular weight: 102.61

Ref: TR-I823976