CymitQuimica logo

CAS 106664-96-4

:

Nonanedioic acid 1,9-bis(2,5-dioxo-1-pyrrolidinyl) ester

Description:
Nonanedioic acid 1,9-bis(2,5-dioxo-1-pyrrolidinyl) ester, also known by its CAS number 106664-96-4, is a chemical compound characterized by its structure, which includes a nonanedioic acid backbone esterified with two pyrrolidinyl groups. This compound typically exhibits properties associated with both the dicarboxylic acid and the pyrrolidinone moieties, such as potential solubility in organic solvents and the ability to form hydrogen bonds due to the presence of carbonyl groups. It may display moderate to high thermal stability, depending on its specific formulation and the conditions under which it is used. The presence of the pyrrolidinyl groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, where its reactivity can be harnessed. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, its unique structure positions it as a compound of interest in various chemical and industrial applications.
Formula:C17H22N2O8
InChI:InChI=1S/C17H22N2O8/c20-12-8-9-13(21)18(12)26-16(24)6-4-2-1-3-5-7-17(25)27-19-14(22)10-11-15(19)23/h1-11H2
InChI key:NCLAPBZZSACEQS-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1=O)OC(=O)CCCCCCCC(=O)ON2C(=O)CCC2=O
Synonyms:
  • Nonanedioic acid 1,9-bis(2,5-dioxo-1-pyrrolidinyl) ester
  • bis(2,5-dioxopyrrolidin-1-yl) nonanedioate
Found 4 products.