CymitQuimica logo

CAS 1067230-65-2

:

(R)-3-Bromomethyl-Pyrrolidine-1-Carboxylic Acid Tert-Butyl Ester

Description:
(R)-3-Bromomethyl-Pyrrolidine-1-Carboxylic Acid Tert-Butyl Ester is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its potential biological activity. The presence of a bromomethyl group at the 3-position of the pyrrolidine enhances its reactivity and may influence its interaction with biological targets. The tert-butyl ester functional group provides steric hindrance, which can affect the compound's solubility and permeability, making it relevant in medicinal chemistry. This compound is typically used in the synthesis of various pharmaceuticals and may serve as an intermediate in the development of drugs targeting specific receptors or enzymes. Its chirality indicates that it may exhibit different biological activities depending on its stereoisomer, which is crucial in drug design. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in research and industry.
Formula:C10H18BrNO2
InChI:InChI=1S/C10H18BrNO2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-7H2,1-3H3/t8-/m0/s1
InChI key:NQNGQGISAMHLST-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N1CC[C@H](C1)CBr
Found 4 products.