CymitQuimica logo

CAS 1067239-08-0

:

1-[(tert-butoxy)carbonyl]-3-hydroxypyrrolidine-3-carboxylic acid

Description:
1-[(tert-butoxy)carbonyl]-3-hydroxypyrrolidine-3-carboxylic acid is a chemical compound characterized by its pyrrolidine ring structure, which includes a hydroxyl group and a carboxylic acid functional group. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amine, enhancing the compound's stability and solubility in organic solvents. This compound is typically used in organic synthesis, particularly in the preparation of peptides and other nitrogen-containing compounds. Its molecular structure contributes to its potential applications in medicinal chemistry, where it may serve as an intermediate in drug development. The presence of both hydroxyl and carboxylic acid functionalities allows for various chemical reactions, including esterification and amidation. Additionally, the compound's solubility characteristics can vary based on the solvent used, making it versatile for different synthetic pathways. Overall, this compound exemplifies the complexity and utility of functionalized cyclic amines in chemical synthesis.
Formula:C10H17NO5
InChI:InChI=1S/C10H17NO5/c1-9(2,3)16-8(14)11-5-4-10(15,6-11)7(12)13/h15H,4-6H2,1-3H3,(H,12,13)
InChI key:XHNNDNBNDDXODX-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(C1)(C(=O)O)O
Found 5 products.