CymitQuimica logo

CAS 1067239-17-1

:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-hydroxycyclobutanecarboxylic acid

Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-hydroxycyclobutanecarboxylic acid, with the CAS number 1067239-17-1, is a chemical compound characterized by its unique structural features, including a cyclobutane ring and multiple functional groups. This compound contains an amino group, a hydroxy group, and a carboxylic acid moiety, which contribute to its potential reactivity and solubility in various solvents. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may exhibit protective characteristics in synthetic applications, particularly in organic synthesis. The cyclobutane structure can impart strain, influencing the compound's stability and reactivity. Additionally, the compound's functional groups may allow for hydrogen bonding, affecting its physical properties such as melting point and solubility. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C10H17NO5
InChI:InChI=1S/C10H17NO5/c1-9(2,3)16-8(14)11-6-4-10(15,5-6)7(12)13/h6,15H,4-5H2,1-3H3,(H,11,14)(H,12,13)
InChI key:InChIKey=VKJURBPNHWOHDW-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CC(C(O)=O)(O)C1
Synonyms:
  • Cyclobutanecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-hydroxy-
  • 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-hydroxycyclobutanecarboxylic acid
Found 3 products.