CAS 106763-37-5

Formula: C4H14Cl2N2

InChI: InChI=1S/C4H12N2.2ClH/c1-4(6)2-3-5;;/h4H,2-3,5-6H2,1H3;2*1H

InChI key: YPHAAVOFLUOLRC-UHFFFAOYSA-N

SMILES: CC(CCN)N.Cl.Cl

Butane-1,3-diamine dihydrochloride

CAS: 106763-37-5

Butane-1,3-diamine dihydrochloride is a potent cytotoxic agent that inhibits the synthesis of fatty acids and histidine. This compound inhibits squamous cell carcinoma cells by decreasing the cytosolic Ca2+ concentration, mitochondrial membrane potential, and cellular ATP levels. It also inhibits the growth of cancer cells by binding to lysine residues on cell membranes. Butane-1,3-diamine dihydrochloride has been synthesized in an asymmetric synthesis to produce a molecule with nitrogen atoms at opposite ends of the molecule. The decarboxylation of this molecule produces butane-1,3-diaminium ion.

Formula: C₄H₁₄Cl₂N₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 161.07 g/mol

Ref: 3D-GEA76337