CymitQuimica logo

CAS 106782-78-9

:

Benzamide, 2-amino-3-methoxy-

Description:
Benzamide, 2-amino-3-methoxy- is an organic compound characterized by the presence of an amide functional group attached to a benzene ring, along with an amino group and a methoxy group. Its molecular structure features a benzene ring substituted with an amino group (-NH2) at the 2-position and a methoxy group (-OCH3) at the 3-position relative to the amide group. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amino and methoxy groups, which can engage in hydrogen bonding. The presence of these functional groups also suggests potential biological activity, making it of interest in pharmaceutical research. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its specific molecular interactions and the environment in which it is studied. Overall, Benzamide, 2-amino-3-methoxy- is a notable compound in organic chemistry with potential applications in various fields.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H2,10,11)
InChI key:KTSGITANKLIJRS-UHFFFAOYSA-N
SMILES:COC1=CC=CC(=C1N)C(=O)N
Found 5 products.