CymitQuimica logo

CAS 1067914-81-1

:

1-benzyl-3,3-difluoropiperidine-4,4-diol

Description:
1-Benzyl-3,3-difluoropiperidine-4,4-diol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a benzyl group indicates that a phenyl ring is attached to the piperidine nitrogen, contributing to its lipophilicity and potential biological activity. The difluoromethyl substituents at the 3 and 3' positions introduce significant electronegativity, which can influence the compound's reactivity and interaction with biological targets. The presence of hydroxyl groups at the 4 and 4' positions suggests that the compound may exhibit hydrogen bonding capabilities, enhancing its solubility in polar solvents and potentially affecting its pharmacokinetic properties. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could impart specific biological activities. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H15F2NO2
InChI:InChI=1S/C12H15F2NO2/c13-11(14)9-15(7-6-12(11,16)17)8-10-4-2-1-3-5-10/h1-5,16-17H,6-9H2
InChI key:VUYVXSSPDOWKFE-UHFFFAOYSA-N
SMILES:C1CN(CC(C1(O)O)(F)F)CC2=CC=CC=C2
Found 5 products.