CymitQuimica logo

CAS 1067975-03-4

:

(2E)-N-Methoxy-N-methyl-2-pentenamide

Description:
(2E)-N-Methoxy-N-methyl-2-pentenamide is an organic compound characterized by its amide functional group, which features a methoxy and a methyl substituent on the nitrogen atom. The presence of a double bond in the pentene chain indicates that it has geometric isomerism, specifically in the E configuration, which refers to the trans arrangement of substituents around the double bond. This compound is likely to exhibit moderate polarity due to the presence of both the methoxy group and the amide functionality, influencing its solubility in polar solvents. The molecular structure suggests potential reactivity typical of amides, including hydrolysis and participation in condensation reactions. Additionally, the compound may possess biological activity, as many amides are known to interact with biological systems. Its specific applications and behavior would depend on further studies, including its stability, reactivity under various conditions, and potential uses in pharmaceuticals or agrochemicals. Overall, (2E)-N-Methoxy-N-methyl-2-pentenamide represents a unique structure within the realm of organic chemistry.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-4-5-6-7(9)8(2)10-3/h5-6H,4H2,1-3H3/b6-5+
InChI key:InChIKey=NWXVJDWUUQRTIS-AATRIKPKSA-N
SMILES:C(N(OC)C)(/C=C/CC)=O
Synonyms:
  • (2E)-N-Methoxy-N-methyl-2-pentenamide
  • 2-Pentenamide, N-methoxy-N-methyl-, (2E)-
Found 1 products.