CymitQuimica logo

CAS 106813-54-1

:

Bicyclo[1.1.1]pentane-1-carboxylic acid, methyl ester (9CI)

Description:
Bicyclo[1.1.1]pentane-1-carboxylic acid, methyl ester, also known by its CAS number 106813-54-1, is an organic compound characterized by its bicyclic structure, which consists of a central bicyclo[1.1.1]pentane framework with a carboxylic acid functional group esterified with a methyl group. This compound typically exhibits a high degree of strain due to its unique bicyclic arrangement, which can influence its reactivity and stability. It is generally a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the ester functional group suggests that it may participate in reactions typical of esters, such as hydrolysis and transesterification. Additionally, its bicyclic nature may impart distinctive physical properties, such as a relatively high boiling point compared to linear or less-strained compounds. Bicyclo[1.1.1]pentane derivatives are of interest in materials science and medicinal chemistry due to their unique structural properties and potential applications in drug design and synthesis.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c1-9-6(8)7-2-5(3-7)4-7/h5H,2-4H2,1H3
InChI key:JLFOFQQASSASLV-UHFFFAOYSA-N
SMILES:COC(=O)C12CC(C1)C2
Found 4 products.