CymitQuimica logo

CAS 1068148-47-9

:

BIBP 3226 trifluoroacetate

Description:
BIBP 3226 trifluoroacetate is a chemical compound that acts as a selective antagonist for the neuropeptide Y (NPY) Y1 receptor, which is involved in various physiological processes, including appetite regulation and cardiovascular function. This compound is characterized by its trifluoroacetate salt form, which enhances its solubility and stability in biological systems. BIBP 3226 is often utilized in pharmacological research to investigate the role of NPY in different biological contexts, including obesity and anxiety disorders. The molecular structure of BIBP 3226 includes specific functional groups that contribute to its binding affinity and selectivity for the Y1 receptor. As a research tool, it provides insights into receptor signaling pathways and potential therapeutic targets. Safety and handling precautions should be observed, as with any chemical substance, and its use is typically confined to laboratory settings under controlled conditions.
Formula:C29H32F3N5O5
InChI:InChI=1S/C27H31N5O3.C2HF3O2/c28-27(29)30-17-7-12-23(25(34)31-18-19-13-15-22(33)16-14-19)32-26(35)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21;3-2(4,5)1(6)7/h1-6,8-11,13-16,23-24,33H,7,12,17-18H2,(H,31,34)(H,32,35)(H4,28,29,30);(H,6,7)/t23-;/m1./s1
InChI key:MTSZIDSCWZHKOD-GNAFDRTKSA-N
SMILES:C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)N[C@H](CCCN=C(N)N)C(=O)NCC3=CC=C(C=C3)O.C(=O)(C(F)(F)F)O
Synonyms:
  • BIBP3226 TFA
Found 3 products.