CymitQuimica logo

CAS 106833-79-8

:

2-PHENYL-1,3-OXAZOLE-5-CARBOXYLIC ACID

Description:
2-Phenyl-1,3-oxazole-5-carboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a phenyl group attached to the oxazole ring, contributing to its aromatic properties. The carboxylic acid functional group at the 5-position of the oxazole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of the phenyl group enhances its potential for interactions in biological systems, possibly influencing its solubility and reactivity. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in the development of new materials or as a building block in organic synthesis. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H7NO3
InChI:InChI=1/C10H7NO3/c12-10(13)8-6-11-9(14-8)7-4-2-1-3-5-7/h1-6H,(H,12,13)
InChI key:PPQVAHVZIBDHDB-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ncc(C(=O)O)o1
Found 4 products.