CymitQuimica logo

CAS 106833-80-1

:

2-(2-Thienyl)-5-oxazolecarboxylic acid

Description:
2-(2-Thienyl)-5-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both a thienyl group and an oxazole ring. The thienyl moiety contributes to its aromatic properties, while the oxazole ring introduces nitrogen and oxygen into the structure, enhancing its reactivity and potential for forming hydrogen bonds. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can also participate in acid-base reactions. The carboxylic acid group is known for its acidity, making this compound potentially useful in various chemical reactions, including esterification and amidation. Additionally, the unique combination of sulfur from the thienyl group and the nitrogen and oxygen from the oxazole ring may impart interesting electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure, which can influence its behavior in biological systems or chemical processes.
Formula:C8H5NO3S
InChI:InChI=1S/C8H5NO3S/c10-8(11)5-4-9-7(12-5)6-2-1-3-13-6/h1-4H,(H,10,11)
InChI key:InChIKey=CCYJSBIENSYLFK-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=NC1)C2=CC=CS2
Synonyms:
  • 2-(Thiophen-2-yl)-1,3-oxazole-5-carboxylic acid
  • 5-Oxazolecarboxylic acid, 2-(2-thienyl)-
  • 2-(2-Thienyl)-5-oxazolecarboxylic acid
Found 1 products.