CymitQuimica logo

CAS 106848-38-8

:

1-BENZYL-4-BROMOIMIDAZOLE

Description:
1-Benzyl-4-bromoimidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a benzyl group at one position and a bromine atom at another position on the imidazole ring contributes to its unique properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, 1-benzyl-4-bromoimidazole may exhibit properties such as solubility in organic solvents and moderate stability under standard laboratory conditions. Its molecular structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C10H9BrN2
InChI:InChI=1S/C10H9BrN2/c11-10-7-13(8-12-10)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2
InChI key:SEDUHBKZBAORFI-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CN2C=C(N=C2)Br
Found 4 products.