CymitQuimica logo

CAS 106850-17-3

:

2-Thiophenecarboxylicacid,5-amino-4-nitro-,methylester(9CI)

Description:
2-Thiophenecarboxylic acid, 5-amino-4-nitro-, methyl ester, commonly referred to by its CAS number 106850-17-3, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. Additionally, it contains an amino group and a nitro group, which are both substituents on the thiophene ring, contributing to its chemical reactivity and potential biological activity. The presence of these functional groups suggests that the compound may exhibit properties such as acidity, basicity, and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's structure may also influence its solubility, stability, and interaction with other molecules, making it of interest in fields such as medicinal chemistry and materials science. Overall, its unique combination of functional groups and heterocyclic structure makes it a valuable compound for further research and application.
Formula:C6H6N2O4S
InChI:InChI=1/C6H6N2O4S/c1-12-6(9)4-2-3(8(10)11)5(7)13-4/h2H,7H2,1H3
InChI key:QNZKSILGWVCZJH-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(c(N)s1)N(=O)=O
Synonyms:
  • Methyl 5-amino-4-nitro-2-thiophenecarboxylate
  • 2-Thiophenecarboxylic acid, 5-amino-4-nitro-, methyl ester
  • Methyl 5-Amino-4-Nitrothiophene-2-Carboxylate
Found 4 products.