CymitQuimica logo

CAS 106861-17-0

:

3-Pyridazinecarbonitrile, 4-methyl-

Description:
3-Pyridazinecarbonitrile, 4-methyl- is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a cyano group (-C≡N) at the 3-position and a methyl group (-CH₃) at the 4-position contributes to its chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in polar organic solvents. It may exhibit moderate to high stability under standard conditions, but like many nitriles, it can be reactive under certain circumstances, particularly in nucleophilic reactions. The compound's structure suggests potential applications in pharmaceuticals and agrochemicals, as derivatives of pyridazine are often explored for their biological activities. Additionally, its unique functional groups may allow for further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H5N3
InChI:InChI=1S/C6H5N3/c1-5-2-3-8-9-6(5)4-7/h2-3H,1H3
InChI key:XVOXNSDLOXACCF-UHFFFAOYSA-N
SMILES:CC1=C(N=NC=C1)C#N
Found 3 products.