CymitQuimica logo

CAS 106867-30-5

:

2-chloro-2'-deoxyadenosine triphosphate

Description:
2-Chloro-2'-deoxyadenosine triphosphate (dClATP) is a modified nucleotide that serves as an analog of deoxyadenosine triphosphate (dATP). It features a chlorine atom at the 2-position of the deoxyribose sugar, which alters its biochemical properties. This compound is typically used in molecular biology and biochemistry as a tool for studying DNA synthesis and repair mechanisms, as well as in the development of antiviral and anticancer therapies. The presence of the chlorine atom can affect the substrate's incorporation into DNA by DNA polymerases, potentially leading to mutations or altered replication processes. dClATP is soluble in water and exhibits stability under physiological conditions, although it may be sensitive to hydrolysis. Its unique structure allows it to participate in various enzymatic reactions, making it a valuable compound in research settings. As with many nucleotides, it plays a crucial role in cellular metabolism and signaling pathways, contributing to the understanding of nucleic acid biochemistry.
Formula:C10H15ClN5O12P3
InChI:InChI=1/C10H15ClN5O12P3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(17)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,17H,1-2H2,(H,21,22)(H,23,24)(H2,12,14,15)(H2,18,19,20)/t4-,5+,6+/m0/s1
InChI key:PZCJNHCKXRBBNN-UHFFFAOYSA-N
SMILES:C1C(C(OC1N2C=NC3=C(N=C(N=C32)Cl)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Synonyms:
  • 2-Chloro-2'-deoxyadenosine triphosphate
  • 2-Chloro-datp
  • 2-chloro-2'-deoxyadenosine 5'-(tetrahydrogen triphosphate)
  • Adenosine 5'-(tetrahydrogen triphosphate), 2-chloro-2'-deoxy-
  • 2-chloro-9-[2-deoxy-5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)pentofuranosyl]-9H-purin-6-amine
Found 1 products.