CymitQuimica logo

CAS 106877-20-7

:

3-methoxy-4-(trifluoromethyl)aniline

Description:
3-Methoxy-4-(trifluoromethyl)aniline, with the CAS number 106877-20-7, is an organic compound that belongs to the class of anilines, which are characterized by the presence of an amino group attached to an aromatic ring. This particular compound features a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) on the aromatic ring, specifically at the 3 and 4 positions, respectively. The presence of the trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. 3-Methoxy-4-(trifluoromethyl)aniline is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit toxicity or environmental concerns. Overall, this compound is of interest in various fields of chemical research and development.
Formula:C8H8F3NO
InChI:InChI=1S/C8H8F3NO/c1-13-7-4-5(12)2-3-6(7)8(9,10)11/h2-4H,12H2,1H3
InChI key:QRLOMWASJXMURT-UHFFFAOYSA-N
SMILES:COc1cc(ccc1C(F)(F)F)N
Found 4 products.