CymitQuimica logo

CAS 106877-34-3

:

3-Chloro-2-(trifluoromethyl)phenol

Description:
3-Chloro-2-(trifluoromethyl)phenol is an organic compound characterized by the presence of a chloro group and a trifluoromethyl group attached to a phenolic structure. Its molecular formula typically includes a phenolic hydroxyl (-OH) group, which contributes to its reactivity and potential applications in various chemical processes. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceuticals and agrochemicals. This compound is generally a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chlorinated structure suggests potential applications in synthesis and as an intermediate in the production of other chemical entities. Additionally, the presence of both chlorine and trifluoromethyl groups may impart unique properties, such as increased stability and resistance to degradation. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 3-Chloro-2-(trifluoromethyl)phenol is a versatile compound with significant implications in chemical research and industry.
Formula:C7H4ClF3O
InChI:InChI=1S/C7H4ClF3O/c8-4-2-1-3-5(12)6(4)7(9,10)11/h1-3,12H
InChI key:InChIKey=WIMFOMTYQPDJBK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C=CC=C1O
Synonyms:
  • 2-Trifluoromethyl-3-chlorophenol
  • 3-Chloro-2-(trifluoromethyl)phenol
  • Phenol, 3-chloro-2-(trifluoromethyl)-
Found 4 products.