CymitQuimica logo

CAS 106877-46-7

:

3-Amino-4-(trifluoromethyl)phenol

Description:
3-Amino-4-(trifluoromethyl)phenol is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a phenolic structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and fluorine atoms, reflecting its functional groups. The amino group (-NH2) contributes to its basicity and potential reactivity, while the trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its electronic properties, making it a valuable compound in various chemical applications. This substance is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique properties. Additionally, its phenolic nature may impart antioxidant characteristics, which can be beneficial in certain formulations. The compound is usually handled with care, as it may exhibit toxicity or environmental hazards, necessitating appropriate safety measures during its use and disposal. Overall, 3-Amino-4-(trifluoromethyl)phenol is a versatile compound with significant implications in chemical research and industry.
Formula:C7H6F3NO
InChI:InChI=1S/C7H6F3NO/c8-7(9,10)5-2-1-4(12)3-6(5)11/h1-3,12H,11H2
InChI key:InChIKey=XHGNKLZHRNUBEV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N)C=C(O)C=C1
Synonyms:
  • 3-Amino-4-trifluoromethylphenol
  • 3-Amino-4-(trifluoromethyl)phenol
  • Phenol, 3-amino-4-(trifluoromethyl)-
Found 2 products.