CAS 106890-70-4
:3-Quinolinecarboxylic acid,1-cyclopropyl-5,6,7,8-tetrafluoro-1,4-dihydro-4-oxo-
Description:
3-Quinolinecarboxylic acid, 1-cyclopropyl-5,6,7,8-tetrafluoro-1,4-dihydro-4-oxo- (CAS 106890-70-4) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a cyclopropyl group introduces strain and unique steric properties, while the tetrafluoro substituents enhance its electron-withdrawing characteristics, influencing its chemical behavior and solubility. The dihydro-4-oxo moiety indicates the presence of a ketone functionality, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound may exhibit interesting biological activities and could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C13H7F4NO3
InChI:InChI=1S/C13H7F4NO3/c14-7-6-11(10(17)9(16)8(7)15)18(4-1-2-4)3-5(12(6)19)13(20)21/h3-4H,1-2H2,(H,20,21)
InChI key:RFZHFIFSQNIHAI-UHFFFAOYSA-N
SMILES:C1CC1N2C=C(C(=O)C3=C2C(=C(C(=C3F)F)F)F)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Cyclopropyl-5,6,7,8-tetrafluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic Acid
CAS:Controlled ProductFormula:C13H7F4NO3Color and Shape:NeatMolecular weight:301.193


