CymitQuimica logo

CAS 106910-79-6

:

(S)-4-Benzyl-5-oxomorpholine-3-carboxylic acid

Description:
(S)-4-Benzyl-5-oxomorpholine-3-carboxylic acid, with the CAS number 106910-79-6, is a chemical compound characterized by its morpholine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a benzyl group and a carboxylic acid functional group, contributing to its potential biological activity. The presence of the oxo group (a carbonyl) at the 5-position enhances its reactivity and may influence its interaction with biological targets. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration being of particular interest in pharmaceutical applications due to its specific interactions with biological receptors. The compound may exhibit properties such as solubility in polar solvents and potential for forming hydrogen bonds due to its functional groups. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C12H13NO4
InChI:InChI=1/C12H13NO4/c14-11-8-17-7-10(12(15)16)13(11)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)/t10-/m0/s1
InChI key:LAHROJZLGLNLBT-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1[C@@H](COCC1=O)C(=O)O
Synonyms:
  • (S)-(+)-4-Benzylmorpholin-5-one-3-carboxylic Acid
  • 4-Benzyl-5-Oxomorpholine-3-Carboxylic Acid
Found 5 products.