CymitQuimica logo

CAS 106913-64-8

:

5-aminopyrimidin-4-ol hydrochloride

Description:
5-Aminopyrimidin-4-ol hydrochloride is a chemical compound characterized by its pyrimidine ring structure, which includes an amino group and a hydroxyl group. This compound is typically a white to off-white crystalline solid, soluble in water and other polar solvents, which is indicative of its functional groups. The presence of the amino group contributes to its basicity, while the hydroxyl group can participate in hydrogen bonding, enhancing its solubility. The hydrochloride form indicates that the compound is a salt, which often improves stability and solubility in aqueous solutions. 5-Aminopyrimidin-4-ol hydrochloride is of interest in pharmaceutical research, particularly for its potential applications in medicinal chemistry, as it may serve as a building block for the synthesis of various bioactive compounds. Its molecular structure allows for interactions with biological targets, making it a subject of study in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H6ClN3O
InChI:InChI=1/C4H5N3O.ClH/c5-3-1-6-2-7-4(3)8;/h1-2H,5H2,(H,6,7,8);1H
InChI key:QNHQWEPCQNAAPX-UHFFFAOYSA-N
SMILES:c1c(c(ncn1)O)N.Cl
Synonyms:
  • 5-Aminopyrimidin-4-ol hydrochloride (1:1)
Found 3 products.