CymitQuimica logo

CAS 106931-79-7

:

Benzoic acid, 3-chloro-4-(phenylmethoxy)-

Description:
Benzoic acid, 3-chloro-4-(phenylmethoxy)-, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a chloro group and a phenylmethoxy group. The presence of the chloro substituent typically imparts unique reactivity and influences the compound's physical properties, such as solubility and boiling point. The phenylmethoxy group enhances the compound's hydrophobic characteristics, potentially affecting its interaction with biological systems and solvents. This compound may exhibit various functional properties, including antimicrobial or antifungal activity, making it of interest in pharmaceutical and agricultural applications. Its molecular structure suggests potential for hydrogen bonding due to the carboxylic acid group, which can influence its acidity and reactivity. Additionally, the compound's stability and behavior under different environmental conditions can be significant for its practical applications. Overall, the combination of these substituents contributes to the compound's unique chemical behavior and potential utility in various fields.
Formula:C14H11ClO3
InChI:InChI=1S/C14H11ClO3/c15-12-8-11(14(16)17)6-7-13(12)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)
InChI key:MQUAYIQAPMFLCC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)O)Cl
Found 4 products.