CymitQuimica logo

CAS 106950-13-4

:

6-Ethyl-4-Methoxy-2-Pyranone

Description:
6-Ethyl-4-Methoxy-2-Pyranone, identified by its CAS number 106950-13-4, is an organic compound belonging to the pyranone class of compounds. It features a six-membered ring structure that includes both oxygen and carbon atoms, contributing to its unique chemical properties. The presence of an ethyl group and a methoxy group enhances its reactivity and solubility in various organic solvents. This compound is characterized by its potential applications in the synthesis of pharmaceuticals, agrochemicals, and flavoring agents due to its interesting chemical reactivity and structural features. Additionally, it may exhibit biological activity, making it a subject of interest in medicinal chemistry. The compound's stability, melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity. Further research may provide insights into its applications and mechanisms of action in various chemical contexts.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-3-6-4-7(10-2)5-8(9)11-6/h4-5H,3H2,1-2H3
InChI key:CRYDMVQAZDVQSO-UHFFFAOYSA-N
SMILES:CCC1=CC(=CC(=O)O1)OC
Found 4 products.