CymitQuimica logo

CAS 106961-33-5

:

DIMETHYL-(6-METHYL-2-P-TOLYL-IMIDAZO[1,2-A]PYRIDIN-3-YLMETHYL)-AMINE

Description:
Dimethyl-(6-methyl-2-p-tolyl-imidazo[1,2-a]pyridin-3-ylmethyl)-amine, with CAS number 106961-33-5, is a chemical compound characterized by its complex structure, which includes an imidazopyridine core and a dimethylamino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methyl and p-tolyl substituents suggests that it may have lipophilic characteristics, which can influence its solubility and interaction with biological membranes. Additionally, the imidazo[1,2-a]pyridine moiety is often associated with pharmacological activity, making this compound of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for various applications, including its potential as a pharmaceutical agent. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its toxicity and environmental impact.
Formula:C18H21N3
InChI:InChI=1S/C18H21N3/c1-13-5-8-15(9-6-13)18-16(12-20(3)4)21-11-14(2)7-10-17(21)19-18/h5-11H,12H2,1-4H3
InChI key:ZKSRNGXLVCJQCC-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=C(N3C=C(C=CC3=N2)C)CN(C)C
Found 9 products.