CymitQuimica logo

CAS 106969-11-3

:

4-chloro-5-(difluoromethoxy)-2-fluoroaniline

Description:
4-Chloro-5-(difluoromethoxy)-2-fluoroaniline is an organic compound characterized by its aromatic amine structure, which includes a chloro group, a difluoromethoxy group, and a fluoro substituent on the benzene ring. This compound features a molecular framework that contributes to its potential applications in pharmaceuticals and agrochemicals. The presence of multiple halogen atoms (chlorine and fluorine) enhances its reactivity and may influence its biological activity, making it a subject of interest in medicinal chemistry. The difluoromethoxy group introduces unique electronic properties, potentially affecting the compound's solubility and interaction with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, which may play a role in its pharmacokinetic properties. Overall, 4-chloro-5-(difluoromethoxy)-2-fluoroaniline exhibits a combination of halogenated substituents that can significantly impact its chemical behavior and applications in various fields.
Formula:C7H5ClF3NO
InChI:InChI=1/C7H5ClF3NO/c8-3-1-4(9)5(12)2-6(3)13-7(10)11/h1-2,7H,12H2
SMILES:c1c(c(cc(c1F)N)OC(F)F)Cl
Found 1 products.