CymitQuimica logo

CAS 106973-36-8

:

(3R)-4-benzyl-5-oxo-morpholine-3-carboxylic acid

Description:
(3R)-4-benzyl-5-oxo-morpholine-3-carboxylic acid is a chemical compound characterized by its morpholine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a benzyl group, contributing to its hydrophobic characteristics, and a carboxylic acid functional group, which imparts acidic properties. The presence of the 5-oxo group indicates a ketone functionality, enhancing its reactivity and potential for forming various derivatives. The stereochemistry at the 3-position (designated as (3R)) suggests that the compound has specific spatial arrangements that can influence its biological activity and interactions with other molecules. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its solubility and stability in various solvents can vary, influencing its application in synthetic processes or as a drug candidate. Overall, (3R)-4-benzyl-5-oxo-morpholine-3-carboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C12H13NO4
InChI:InChI=1/C12H13NO4/c14-11-8-17-7-10(12(15)16)13(11)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)/t10-/m1/s1
InChI key:LAHROJZLGLNLBT-SNVBAGLBSA-N
SMILES:c1ccc(cc1)CN1[C@H](COCC1=O)C(=O)O
Synonyms:
  • (3R)-4-Benzyl-5-oxomorpholine-3-carboxylic acid
  • 3-Morpholinecarboxylic acid, 5-oxo-4-(phenylmethyl)-, (3R)-
Found 5 products.