CymitQuimica logo

CAS 106976-24-3

:

2-Amino-5-bromo-4-methylbenzoic acid

Description:
2-Amino-5-bromo-4-methylbenzoic acid, with the CAS number 106976-24-3, is an organic compound that belongs to the class of amino acids and aromatic carboxylic acids. It features a benzene ring substituted with an amino group (-NH2), a bromine atom (Br), and a methyl group (-CH3), along with a carboxylic acid group (-COOH). This compound is characterized by its relatively high melting point and solubility in polar solvents due to the presence of the carboxylic acid and amino functional groups, which can engage in hydrogen bonding. The bromine substituent introduces a halogen, which can influence the compound's reactivity and stability. 2-Amino-5-bromo-4-methylbenzoic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,10H2,1H3,(H,11,12)
InChI key:PJGDLDZLEKENNP-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1Br)C(=O)O)N
Found 4 products.