CymitQuimica logo

CAS 106976-50-5

:

Benzoic acid, 2-ethyl-6-methyl-

Description:
Benzoic acid, 2-ethyl-6-methyl- (CAS 106976-50-5) is an aromatic carboxylic acid characterized by a benzene ring substituted with an ethyl group at the 2-position and a methyl group at the 6-position. This compound typically appears as a white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. Its molecular structure contributes to its unique properties, including moderate acidity, which is typical of carboxylic acids. Benzoic acid derivatives often exhibit antimicrobial properties, making them useful in various applications, including food preservation and pharmaceuticals. The presence of the ethyl and methyl groups can influence its reactivity and interaction with other substances, potentially affecting its behavior in chemical reactions. Additionally, this compound may be utilized in the synthesis of other organic compounds, highlighting its significance in organic chemistry and industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-3-8-6-4-5-7(2)9(8)10(11)12/h4-6H,3H2,1-2H3,(H,11,12)
InChI key:GGDNRIZDWFLMSI-UHFFFAOYSA-N
SMILES:CCC1=CC=CC(=C1C(=O)O)C
Found 4 products.