CymitQuimica logo

CAS 106981-59-3

:

5-nitro-2-(1H-pyrrol-1-yl)benzonitrile

Description:
5-Nitro-2-(1H-pyrrol-1-yl)benzonitrile is an organic compound characterized by its complex structure, which includes a nitro group, a pyrrole ring, and a benzonitrile moiety. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and stability. The pyrrole ring contributes to the compound's aromatic character and can participate in various chemical reactions, such as electrophilic substitutions. This compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its aromatic nature may enhance its stability under certain conditions. Additionally, the presence of the benzonitrile group suggests potential applications in pharmaceuticals or agrochemicals, as compounds with similar structures are often investigated for biological activity. Overall, 5-nitro-2-(1H-pyrrol-1-yl)benzonitrile is a notable compound in organic chemistry, with properties that may be leveraged in various synthetic and medicinal chemistry applications.
Formula:C11H7N3O2
InChI:InChI=1/C11H7N3O2/c12-8-9-7-10(14(15)16)3-4-11(9)13-5-1-2-6-13/h1-7H
SMILES:c1ccn(c1)c1ccc(cc1C#N)N(=O)=O
Found 2 products.