CymitQuimica logo

CAS 106983-27-1

:

N-(3-OXOOCTANOYL)-DL-HOMOSERINE LACTONE

Description:
N-(3-Oxooctanoyl)-DL-homoserine lactone, identified by its CAS number 106983-27-1, is a chemical compound that belongs to the class of acyl homoserine lactones (AHLs). These compounds are known for their role in quorum sensing, a communication mechanism used by bacteria to coordinate group behaviors based on population density. This particular AHL features a lactone ring and an acyl chain, which contributes to its biological activity. The presence of the 3-oxo group in the acyl chain enhances its stability and reactivity, making it a significant molecule in microbial signaling. N-(3-Oxooctanoyl)-DL-homoserine lactone is typically characterized by its ability to induce gene expression in response to specific bacterial populations, influencing processes such as biofilm formation, virulence, and bioluminescence. Its structural properties, including the length of the acyl chain and the functional groups present, play a crucial role in determining its interaction with bacterial receptors and its overall efficacy in quorum sensing.
Formula:C12H19NO4
InChI:InChI=1S/C12H19NO4/c1-2-3-4-5-9(14)8-11(15)13-10-6-7-17-12(10)16/h10H,2-8H2,1H3,(H,13,15)
InChI key:FXCMGCFNLNFLSH-UHFFFAOYSA-N
SMILES:CCCCCC(=O)CC(=O)NC1CCOC1=O
Found 4 products.