CAS 1070166-11-8
:3,5-Di(pyridin-2-yl)phenylboronic acid
Description:
3,5-Di(pyridin-2-yl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with two pyridine rings at the 3 and 5 positions. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of pyridine rings contributes to its potential as a ligand in coordination chemistry and may enhance its solubility in polar solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems. Its boronic acid functionality allows for participation in Suzuki-Miyaura cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Overall, 3,5-Di(pyridin-2-yl)phenylboronic acid is a versatile compound with applications in both academic research and industrial processes.
Formula:C16H13BN2O2
InChI:InChI=1S/C16H13BN2O2/c20-17(21)14-10-12(15-5-1-3-7-18-15)9-13(11-14)16-6-2-4-8-19-16/h1-11,20-21H
InChI key:XERXVQRMICFJAM-UHFFFAOYSA-N
SMILES:B(C1=CC(=CC(=C1)C2=CC=CC=N2)C3=CC=CC=N3)(O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

