CymitQuimica logo

CAS 107017-73-2

:

N-Boc-1-Amino-Cyclopropanemethanol

Description:
N-Boc-1-Amino-Cyclopropanemethanol is a chemical compound characterized by its unique structure, which includes a cyclopropane ring, an amino group, and a tert-butyloxycarbonyl (Boc) protecting group. The presence of the Boc group makes this compound particularly useful in organic synthesis, as it can protect the amino group during various chemical reactions. The cyclopropane moiety contributes to the compound's rigidity and can influence its reactivity and interaction with other molecules. This compound is typically used in the synthesis of more complex organic molecules, particularly in the pharmaceutical industry, where it may serve as an intermediate in the development of bioactive compounds. Its solubility and stability in various solvents can vary, making it important to consider these factors during experimental procedures. Additionally, the compound's reactivity can be influenced by the presence of functional groups, making it a versatile building block in synthetic chemistry. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-8(2,3)13-7(12)10-9(6-11)4-5-9/h11H,4-6H2,1-3H3,(H,10,12)
InChI key:HFMAZNJKNNRONT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1(CC1)CO
Synonyms:
  • Tert-Butyl 1-(Hydroxymethyl)Cyclopropylcarbamate
  • 1-(Boc-amino)cyclopropylmethanol
Found 5 products.