CymitQuimica logo

CAS 107022-06-0

:

Butanoic-4,4-d2acid, 4-amino- (9CI)

Description:
Butanoic-4,4-d2acid, 4-amino- (9CI), with the CAS number 107022-06-0, is a deuterated derivative of butanoic acid, featuring a four-carbon chain with an amino group at the fourth carbon position. The presence of deuterium (D) at the 4,4 position indicates that two hydrogen atoms in the butanoic acid structure have been replaced with deuterium isotopes, which can be useful in various applications, including NMR spectroscopy and metabolic studies. This compound is characterized by its carboxylic acid functional group, which imparts acidic properties, and the amino group, which can participate in hydrogen bonding and influence the compound's reactivity and solubility. The deuteration can also affect the compound's physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. Butanoic-4,4-d2acid, 4-amino- is typically used in research settings, particularly in studies involving isotopic labeling and tracing in biochemical pathways.
Formula:C4H7D2NO2
InChI:InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/i3D2
InChI key:BTCSSZJGUNDROE-SMZGMGDZSA-N
SMILES:[2H]C([2H])(CCC(=O)O)N
Found 3 products.