CymitQuimica logo

CAS 107023-66-5

:

Cyanomethylmethylnitroaniline

Description:
Cyanomethylmethylnitroaniline, identified by its CAS number 107023-66-5, is an organic compound that features a complex structure incorporating a cyanomethyl group, a methyl group, and a nitroaniline moiety. This compound is characterized by its aromatic nature due to the presence of the aniline group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The nitro group introduces significant polarity and can influence the compound's solubility and reactivity. Additionally, the presence of the cyano group enhances its potential for nucleophilic reactions. The compound's physical properties, such as melting point, boiling point, and solubility, can vary based on its specific molecular interactions and the environment. Safety data sheets would typically indicate that it should be handled with care, as compounds containing nitro and cyano groups can pose health risks and environmental hazards. Overall, Cyanomethylmethylnitroaniline is a specialized chemical with unique properties that warrant careful consideration in its handling and application.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-11(7-6-10)8-2-4-9(5-3-8)12(13)14/h2-5H,7H2,1H3
InChI key:DJOYTAUERRJRAT-UHFFFAOYSA-N
SMILES:CN(CC#N)c1ccc(cc1)N(=O)=O
Synonyms:
  • N-Cyanomethyl-N-methyl-4-nitroaniline
  • [Methyl(4-Nitrophenyl)Amino]Acetonitrile
Found 4 products.