CymitQuimica logo

CAS 107027-34-9

:

8-methyl-2-phenylquinoline-4-carboxylic acid

Description:
8-Methyl-2-phenylquinoline-4-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features a methyl group at the 8-position and a phenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and reactivity, making it useful in various chemical reactions, including esterification and amidation. The presence of both aromatic and heterocyclic components in its structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Its CAS number, 107027-34-9, serves as a unique identifier for regulatory and research purposes. Overall, 8-methyl-2-phenylquinoline-4-carboxylic acid is a versatile compound with significant potential in various fields of chemistry and biochemistry.
Formula:C17H13NO2
InChI:InChI=1/C17H13NO2/c1-11-6-5-9-13-14(17(19)20)10-15(18-16(11)13)12-7-3-2-4-8-12/h2-10H,1H3,(H,19,20)
InChI key:KNNHBYHNBLIQDB-UHFFFAOYSA-N
SMILES:Cc1cccc2c(cc(c3ccccc3)nc12)C(=O)O
Synonyms:
  • 4-Quinolinecarboxylic acid, 8-methyl-2-phenyl-
Found 3 products.