CymitQuimica logo

CAS 107027-35-0

:

8-Methyl-2-(2-pyridinyl)-4-quinolinecarboxylic acid

Description:
8-Methyl-2-(2-pyridinyl)-4-quinolinecarboxylic acid, identified by its CAS number 107027-35-0, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core structure, which is characterized by a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a methyl group at the 8-position and a pyridinyl group at the 2-position contributes to its unique chemical properties and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interactions with biological targets. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial and anticancer activities. Additionally, the structural features of 8-Methyl-2-(2-pyridinyl)-4-quinolinecarboxylic acid may allow for various synthetic modifications, making it a valuable compound in medicinal chemistry and drug development.
Formula:C16H12N2O2
InChI:InChI=1S/C16H12N2O2/c1-10-5-4-6-11-12(16(19)20)9-14(18-15(10)11)13-7-2-3-8-17-13/h2-9H,1H3,(H,19,20)
InChI key:InChIKey=OCXAIJJVNVWYHI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=CC=N3)C(C)=CC=C2
Synonyms:
  • 4-Quinolinecarboxylic Acid, 8-Methyl-2-(2-Pyridinyl)-
  • 8-Methyl-2-(2-pyridinyl)-4-quinolinecarboxylic acid
Found 2 products.