CymitQuimica logo

CAS 107027-41-8

:

2-(3-methoxyphenyl)-8-methylquinoline-4-carboxylic acid

Description:
2-(3-Methoxyphenyl)-8-methylquinoline-4-carboxylic acid, with the CAS number 107027-41-8, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a methoxy group on the phenyl ring and a carboxylic acid functional group contributes to its chemical reactivity and potential biological activity. The methyl group at the 8-position of the quinoline enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in fields such as pharmaceuticals, agrochemicals, or as a research tool in biochemical studies. However, specific properties such as solubility, melting point, and spectral data would require further investigation or experimental determination for comprehensive characterization.
Formula:C18H15NO3
InChI:InChI=1/C18H15NO3/c1-11-5-3-8-14-15(18(20)21)10-16(19-17(11)14)12-6-4-7-13(9-12)22-2/h3-10H,1-2H3,(H,20,21)
SMILES:Cc1cccc2c(cc(c3cccc(c3)OC)nc12)C(=O)O
Synonyms:
  • 4-Quinolinecarboxylic Acid, 2-(3-Methoxyphenyl)-8-Methyl-
Found 1 products.