CymitQuimica logo

CAS 1070295-03-2

:

1(2H)-Isoquinolinone, 6-bromo-4-methyl-

Description:
1(2H)-Isoquinolinone, 6-bromo-4-methyl- is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system comprising a benzene ring fused to a pyridine-like ring. The presence of a bromine atom at the 6-position and a methyl group at the 4-position contributes to its unique reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. The bromine substituent can enhance its reactivity in electrophilic substitution reactions, while the methyl group may influence steric hindrance and electronic properties. Isoquinolinones are often of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and anticancer properties. The compound's specific applications and behavior in chemical reactions can vary based on its functional groups and the surrounding environment. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c1-6-5-12-10(13)8-3-2-7(11)4-9(6)8/h2-5H,1H3,(H,12,13)
InChI key:JDBGODNRIMUHRR-UHFFFAOYSA-N
SMILES:CC1=CNC(=O)C2=C1C=C(C=C2)Br
Synonyms:
  • 1(2H)-Isoquinolinone, 6-bromo-4-methyl-
  • 6-Bromo-4-methyl-2H-isoquinolin-1-one
  • 6-Bromo-4-methylisoquinolin-1(2H)-one
Found 4 products.