CAS 1071-36-9
:Acetic acid, 2-cyano-, sodium salt (1:1)
Description:
Acetic acid, 2-cyano-, sodium salt (1:1), commonly referred to as sodium cyanoacetate, is an organic compound characterized by its salt formation from acetic acid and cyanoacetic acid. It appears as a white crystalline solid and is soluble in water, making it useful in various chemical applications. The compound features both a cyano group (-CN) and a carboxylate group (-COO^-), which contribute to its reactivity and ability to participate in nucleophilic substitution reactions. Sodium cyanoacetate is often utilized in organic synthesis, particularly in the formation of carbon-carbon bonds and as a building block in the synthesis of pharmaceuticals and agrochemicals. Its properties include moderate toxicity, and it should be handled with care in laboratory settings. Additionally, it can act as a source of cyanide under certain conditions, necessitating appropriate safety measures during its use. Overall, sodium cyanoacetate is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C3H3NO2·Na
InChI:InChI=1S/C3H3NO2.Na/c4-2-1-3(5)6;/h1H2,(H,5,6);
InChI key:InChIKey=NLBFDFIZQKPFKP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C#N.[Na]
Synonyms:- Sodium cyanoacetate
- 2-Cyanoacetic acid sodium salt
- Acetic acid, cyano-, sodium salt
- Acetic acid, 2-cyano-, sodium salt (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Sodium cyanoacetate
CAS:<p>Sodium cyanoacetate is an analytical reagent that is used to detect the presence of active methylene in chemical reactions. It can be used as a solid catalyst for wastewater treatment and has been shown to have anti-inflammatory effects. The reaction solution between sodium carbonate, hydrochloric acid, and vibrational energy produces sodium cyanate. Sodium cyanate is then reacted with malonic acid in a dehydration reaction to give hydrogen chloride and chloride. This process can be used to produce pharmaceuticals such as acetaminophen (paracetamol) by reacting the hydrogen chloride with para-nitrophenyl chloroformate.</p>Formula:C3H2NO2·NaPurity:Min. 95%Color and Shape:LiquidMolecular weight:107.04 g/mol
