CAS 1072-67-9
:3-Amino-5-methylisoxazole
Description:
3-Amino-5-methylisoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the isoxazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of the amino group allows for hydrogen bonding, influencing its interactions in biological systems. 3-Amino-5-methylisoxazole is of interest in medicinal chemistry and research due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its molecular structure allows for various modifications, making it a versatile building block in the synthesis of more complex compounds. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C4H6N2O
InChI:InChI=1S/C4H6N2O/c1-3-2-4(5)6-7-3/h2H,1H3,(H2,5,6)
InChI key:InChIKey=FKPXGNGUVSHWQQ-UHFFFAOYSA-N
SMILES:NC=1C=C(C)ON1
Synonyms:- 3-Amino-5-Methyl-Isoxazole
- 3-Isoxazolamine, 5-methyl-
- 5-Methyl-1,2-oxazol-3-amine
- 5-Methyl-3-aminoisoxazole
- 5-Methyl-3-isoxazolamine
- 5-Methyl-3-isoxazolylamine
- Isoxazole, 3-amino-5-methyl-
- NSC 159134
- 3-Amino-5-methylisoxazole
- 3-Amino-5-methylisoxazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
3-Amino-5-methylisoxazole
CAS:Formula:C4H6N2OPurity:>97.0%(GC)(T)Color and Shape:White to Brown powder to crystalMolecular weight:98.11Sulfamethoxazole Related Compound C (5-methylisoxazol-3-amine)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C4H6N2OColor and Shape:Light Yellow PowderMolecular weight:98.048013-Amino-5-methylisoxazole
CAS:3-Amino-5-methylisoxazoleFormula:C4H6N2OPurity:97%Color and Shape:Pale yellow SolidMolecular weight:98.103243-Amino-5-methylisoxazole, 10mM (in DMSO)
CAS:3-Amino-5-methylisoxazole, 10mM (in DMSO)Formula:C4H6N2OPurity:≥98%, 10 mM in DMSOMolecular weight:98.13-Amino-5-methylisoxazole
CAS:Formula:C4H6N2OPurity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:98.103-Amino-5-methylisoxazole
CAS:3-Amino-5-methylisoxazole is pharmaceutical intermediates, used in the production of sulfonamide drugs.Formula:C4H6N2OPurity:98.36% - 99.02%Color and Shape:Slightly Yellow FlakesMolecular weight:98.13-Amino-5-methylisoxazole
CAS:3-Amino-5-methylisoxazole is a chemical compound that is used in the treatment of wastewater. It belongs to the group of p2, which includes sulfamethoxazole and sulfa drugs. 3-Amino-5-methylisoxazole is activated by multi-walled carbon or fatty acid and has a neutral pH. It has been shown to have significant cytotoxicity against cancer cells and also has antibiotic combinations with other drugs. 3-Amino-5-methylisoxazole is a drug that can be used in chemotherapy, but it may cause drug reactions.
Formula:C4H6N2OPurity:Min. 95%Molecular weight:98.1 g/mol











