CAS 1072-93-1
:Epigoitrin
Description:
Epigoitrin, with the CAS number 1072-93-1, is a chemical compound that belongs to the class of glucosinolates, which are sulfur-containing compounds commonly found in cruciferous vegetables. It is characterized by its role as a natural defense mechanism in plants, providing protection against herbivores and pathogens. Epigoitrin is known for its potential biological activities, including antimicrobial and anticancer properties, which have garnered interest in pharmacological research. The compound is typically found in its natural form as a precursor to other bioactive metabolites. Its structure includes a thioglucose moiety, which is responsible for its reactivity and interaction with biological systems. In terms of solubility, epigoitrin is generally soluble in polar solvents, which facilitates its extraction from plant sources. The study of epigoitrin and its derivatives continues to be an area of interest due to their potential health benefits and applications in food science and medicine.
Formula:C5H7NOS
InChI:InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m1/s1
InChI key:InChIKey=UZQVYLOFLQICCT-SCSAIBSYSA-N
SMILES:C(=C)[C@H]1OC(=S)NC1
Synonyms:- (-)5-Vinyl-2-oxazolidinethione
- (5R)-5-Ethenyl-2-oxazolidinethione
- (5R)-5-ethenyl-1,3-oxazolidine-2-thione
- (R)-5-Vinyloxazolidine-2-thione
- 2-Oxazolidinethione, 5-ethenyl-, (5R)-
- 2-Oxazolidinethione, 5-ethenyl-, (R)-
- 2-Oxazolidinethione, 5-vinyl-, (R)-
- 5-Ethenyl-1,3-Oxazolidine-2-Thione
- 5-Vinyl-2-THIOOXAZOLIDONE
- Ba 51-090278
- Epigoitrin
- R-Goitrin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(5R)-5-ethenyl-1,3-oxazolidine-2-thione
CAS:Formula:C5H7NOSPurity:98%Color and Shape:SolidMolecular weight:129.1802Epigoitrin
CAS:1. Epigoitrin (Goitrin) has anti-virus activity. 2. Epigoitrin has anti-oxidant activity. 3. Epigoitrin has anti-inflammation activity.Formula:C5H7NOSPurity:99.96%Color and Shape:SolidMolecular weight:129.18Epigoitrin
CAS:Epigoitrin is an organic compound, classified as a goitrogen, which is a naturally occurring substance found in certain plants, particularly in the Cruciferae family, including Brassica species like cabbage and turnips. It exerts its biological effects through interference with thyroid hormone synthesis. The mode of action involves the inhibition of iodine uptake by the thyroid gland, which is crucial for the synthesis of thyroid hormones.Formula:C5H7NOSPurity:Min 98%Color and Shape:PowderMolecular weight:129.18 g/molEpigoitrin
CAS:Epigoitrin is a naturally occurring compound, specifically a glucosinolate, which is found in cruciferous plants such as cabbage, Brussels sprouts, and kale. This compound originates from the class of phytochemicals produced by these plants as a defense mechanism against pests and diseases.
Formula:C5H7NOSMolecular weight:129.18 g/molRef: 3D-Q-100044
25mgTo inquire50mgTo inquire100mgTo inquire250mgTo inquire500mgTo inquire-Unit-ggTo inquire








