CymitQuimica logo

CAS 1072141-30-0

:

4-Bromo-3-chloro-5-nitropyridine

Description:
4-Bromo-3-chloro-5-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three distinct substituents: a bromine atom at the 4-position, a chlorine atom at the 3-position, and a nitro group at the 5-position of the pyridine ring. These substituents contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogens (bromine and chlorine) and a nitro group enhances its electrophilic character, making it a useful intermediate in organic synthesis. Additionally, the compound's polar nature due to the nitro group may influence its solubility in different solvents. Safety considerations should be taken into account when handling this compound, as halogenated and nitro-substituted compounds can exhibit toxicity and environmental persistence. Overall, 4-Bromo-3-chloro-5-nitropyridine is a valuable compound in synthetic organic chemistry, with potential applications in developing biologically active molecules.
Formula:C5H2BrClN2O2
InChI:InChI=1S/C5H2BrClN2O2/c6-5-3(7)1-8-2-4(5)9(10)11/h1-2H
InChI key:BFEIQRUZMAVRGH-UHFFFAOYSA-N
SMILES:c1c(c(c(cn1)N(=O)=O)Br)Cl
Found 5 products.