CAS 1072957-71-1: Benzovindiflupyr
Description:Benzovindiflupyr is a chemical compound classified as a fungicide, primarily used in agricultural applications to control various fungal diseases in crops. It belongs to the class of compounds known as pyrimidines and features a complex molecular structure that includes a benzene ring fused with a pyrimidine moiety. This compound exhibits a broad spectrum of activity against several fungal pathogens, making it effective in protecting crops such as cereals and vegetables. Benzovindiflupyr operates through a unique mode of action, inhibiting the respiration of fungi by targeting specific enzymes in the mitochondrial electron transport chain. It is characterized by its relatively low toxicity to non-target organisms, including beneficial insects and mammals, which makes it a favorable choice in integrated pest management strategies. Additionally, its stability and persistence in the environment contribute to its effectiveness, although careful management is necessary to mitigate potential resistance development in target fungal populations. Overall, Benzovindiflupyr represents a valuable tool in modern agriculture for sustainable crop protection.
Formula:C18H15Cl2F2N3O
InChI:InChI=1S/C18H15Cl2F2N3O/c1-25-7-11(15(24-25)17(21)22)18(26)23-12-4-2-3-8-9-5-6-10(13(8)12)14(9)16(19)20/h2-4,7,9-10,17H,5-6H2,1H3,(H,23,26)
InChI key:InChIKey=CCCGEKHKTPTUHJ-UHFFFAOYSA-N
SMILES:O=C(NC1=CC=CC2=C1C3C(=C(Cl)Cl)C2CC3)C4=CN(N=C4C(F)F)C
