CAS 1073-39-8

4-Bromobenzocyclobutene

Description:

4-Bromobenzocyclobutene is an organic compound characterized by its unique structure, which combines a bromobenzene moiety with a cyclobutene ring. This compound features a bromine atom attached to the para position of the benzene ring, influencing its reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. 4-Bromobenzocyclobutene is also notable for its potential applications in materials science, particularly in the synthesis of polymers and as a building block in organic synthesis. Its relatively low boiling point and moderate solubility in organic solvents facilitate its use in laboratory settings. However, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.

Formula: C₈H₅Br

InChI: InChI=1/C8H7Br/c9-8-4-3-6-1-2-7(6)5-8/h3-5H,1-2H2

SMILES: C1Cc2cc(ccc12)Br

Synonyms:

• 3-Bromo-Bicyclo[4.2.0]Octa-1,3,5-Triene
• 4-Bromobenzocyclobutene

3-Bromobicyclo[4.2.0]octa-1,3,5-triene

CAS: 1073-39-8

Formula: C₈H₇Br

Purity: 97%

Color and Shape: Liquid

Molecular weight: 183.0452

Ref: IN-DA0033YB

3-Bromobicyclo[4.2.0]octa-1,3,5-triene

CAS: 1073-39-8

3-Bromobicyclo[4.2.0]octa-1,3,5-triene

Purity: 98%

Molecular weight: 183.05g/mol

Ref: 54-OR75296

3-Bromobicyclo[4.2.0]octa-1,3,5-triene

CAS: 1073-39-8

Formula: C₈H₇Br

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 183.05

Ref: 3B-B6357

3-Bromobicyclo[4.2.0]octa-1,3,5-triene

CAS: 1073-39-8

Formula: C₈H₇Br

Purity: 95%

Color and Shape: Liquid

Molecular weight: 183.048

Ref: 10-F079227