CymitQuimica logo

CAS 1073-39-8

:

4-Bromobenzocyclobutene

Description:
4-Bromobenzocyclobutene is an organic compound characterized by its unique structure, which combines a bromobenzene moiety with a cyclobutene ring. This compound features a bromine atom attached to the para position of the benzene ring, influencing its reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. 4-Bromobenzocyclobutene is also notable for its potential applications in materials science, particularly in the synthesis of polymers and as a building block in organic synthesis. Its relatively low boiling point and moderate solubility in organic solvents facilitate its use in laboratory settings. However, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C8H5Br
InChI:InChI=1/C8H7Br/c9-8-4-3-6-1-2-7(6)5-8/h3-5H,1-2H2
InChI key:GMHHTGYHERDNLO-UHFFFAOYSA-N
SMILES:C1Cc2cc(ccc12)Br
Synonyms:
  • 3-Bromo-Bicyclo[4.2.0]Octa-1,3,5-Triene
  • 4-Bromobenzocyclobutene
Found 5 products.